2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid

C11H9F3N2O2 — CID 43244294

IUPAC2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid
SMILESCc1nc2cc(C(=O)O)ccc2n1CC(F)(F)F
InChIInChI=1S/C11H9F3N2O2/c1-6-15-8-4-7(10(17)18)2-3-9(8)16(6)5-11(12,13)14/h2-4H,5H2,1H3,(H,17,18)
InChIKeyFXZIXZKGHOREOM-UHFFFAOYSA-N
MW258.20 g/mol
LogP2.61
Rot. Bonds2

About 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid

2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid (PubChem CID 43244294) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid.

Molecular Properties

Compound Name2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid
PubChem CID43244294
Molecular FormulaC11H9F3N2O2
Molecular Weight258.20 g/mol
Exact Mass258.06
IUPAC Name2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid
SMILESCc1nc2cc(C(=O)O)ccc2n1CC(F)(F)F
InChIInChI=1S/C11H9F3N2O2/c1-6-15-8-4-7(10(17)18)2-3-9(8)16(6)5-11(12,13)14/h2-4H,5H2,1H3,(H,17,18)
InChIKeyFXZIXZKGHOREOM-UHFFFAOYSA-N
XLogP2.61
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.20
LogP ≤ 52.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid?
The IUPAC name of 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid (CID 43244294) is 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid.
What is the SMILES notation for 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid?
The canonical SMILES for 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid is Cc1nc2cc(C(=O)O)ccc2n1CC(F)(F)F.
What is the InChIKey of 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid?
The InChIKey is FXZIXZKGHOREOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O2/c1-6-15-8-4-7(10(17)18)2-3-9(8)16(6)5-11(12,13)14/h2-4H,5H2,1H3,(H,17,18).
What are the key properties of 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid?
2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid has a molecular weight of 258.20 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(2,2,2-trifluoroethyl)benzimidazole-5-carboxylic acid is sourced from PubChem (CID 43244294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).