C13H15F3N2S — CID 115520864
5-methyl-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione (PubChem CID 115520864) has the molecular formula C13H15F3N2S and a molecular weight of 288.34 g/mol. Its IUPAC name is 5-methyl-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-methyl-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115520864 |
| Molecular Formula | C13H15F3N2S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 5-methyl-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(CCCCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H15F3N2S/c1-9-4-5-10-11(8-9)18(12(19)17-10)7-3-2-6-13(14,15)16/h4-5,8H,2-3,6-7H2,1H3,(H,17,19) |
| InChIKey | CWUYXONODCIMAP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|