C16H20N4S — CID 114537977
3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-methyl-1H-benzimidazole-2-thione (PubChem CID 114537977) has the molecular formula C16H20N4S and a molecular weight of 300.43 g/mol. Its IUPAC name is 3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114537977 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(CCCn3nc(C)cc3C)c2c1 |
| InChI | InChI=1S/C16H20N4S/c1-11-5-6-14-15(9-11)19(16(21)17-14)7-4-8-20-13(3)10-12(2)18-20/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,21) |
| InChIKey | GCQDWQMFYYKHPT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|