C14H15N3S2 — CID 106034332
5-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 106034332) has the molecular formula C14H15N3S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 5-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106034332 |
| Molecular Formula | C14H15N3S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(CCc3csc(C)n3)c2c1 |
| InChI | InChI=1S/C14H15N3S2/c1-9-3-4-12-13(7-9)17(14(18)16-12)6-5-11-8-19-10(2)15-11/h3-4,7-8H,5-6H2,1-2H3,(H,16,18) |
| InChIKey | SGYFNDYCQCUKEI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|