C13H12BrN3S2 — CID 106034382
5-bromo-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 106034382) has the molecular formula C13H12BrN3S2 and a molecular weight of 354.30 g/mol. Its IUPAC name is 5-bromo-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-bromo-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106034382 |
| Molecular Formula | C13H12BrN3S2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 5-bromo-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1nc(CCn2c(=S)[nH]c3ccc(Br)cc32)cs1 |
| InChI | InChI=1S/C13H12BrN3S2/c1-8-15-10(7-19-8)4-5-17-12-6-9(14)2-3-11(12)16-13(17)18/h2-3,6-7H,4-5H2,1H3,(H,16,18) |
| InChIKey | NSVFZWVHZXDKRK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|