C14H13BrN2S2 — CID 106034797
3-[2-(5-bromothiophen-2-yl)ethyl]-5-methyl-1H-benzimidazole-2-thione (PubChem CID 106034797) has the molecular formula C14H13BrN2S2 and a molecular weight of 353.31 g/mol. Its IUPAC name is 3-[2-(5-bromothiophen-2-yl)ethyl]-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-[2-(5-bromothiophen-2-yl)ethyl]-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106034797 |
| Molecular Formula | C14H13BrN2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 3-[2-(5-bromothiophen-2-yl)ethyl]-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(CCc3ccc(Br)s3)c2c1 |
| InChI | InChI=1S/C14H13BrN2S2/c1-9-2-4-11-12(8-9)17(14(18)16-11)7-6-10-3-5-13(15)19-10/h2-5,8H,6-7H2,1H3,(H,16,18) |
| InChIKey | WODSQDZBJBJYNJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|