C14H10BrN3S2 — CID 106034852
3-[2-(5-bromothiophen-2-yl)ethyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile (PubChem CID 106034852) has the molecular formula C14H10BrN3S2 and a molecular weight of 364.29 g/mol. Its IUPAC name is 3-[2-(5-bromothiophen-2-yl)ethyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile.
| Compound Name | 3-[2-(5-bromothiophen-2-yl)ethyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 106034852 |
| Molecular Formula | C14H10BrN3S2 |
| Molecular Weight | 364.29 g/mol |
| Exact Mass | 362.95 |
| IUPAC Name | 3-[2-(5-bromothiophen-2-yl)ethyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=S)n(CCc3ccc(Br)s3)c2c1 |
| InChI | InChI=1S/C14H10BrN3S2/c15-13-4-2-10(20-13)5-6-18-12-7-9(8-16)1-3-11(12)17-14(18)19/h1-4,7H,5-6H2,(H,17,19) |
| InChIKey | WDADMPDWVBIRLE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|