C10H6F3N3S — CID 113444487
2-sulfanylidene-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbonitrile (PubChem CID 113444487) has the molecular formula C10H6F3N3S and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-sulfanylidene-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbonitrile.
| Compound Name | 2-sulfanylidene-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 113444487 |
| Molecular Formula | C10H6F3N3S |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-sulfanylidene-3-(2,2,2-trifluoroethyl)-1H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=S)n(CC(F)(F)F)c2c1 |
| InChI | InChI=1S/C10H6F3N3S/c11-10(12,13)5-16-8-3-6(4-14)1-2-7(8)15-9(16)17/h1-3H,5H2,(H,15,17) |
| InChIKey | IDLZKTSXWXRDCK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|