C15H13N3S2 — CID 106005945
3-[(5-ethylthiophen-2-yl)methyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile (PubChem CID 106005945) has the molecular formula C15H13N3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 3-[(5-ethylthiophen-2-yl)methyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile.
| Compound Name | 3-[(5-ethylthiophen-2-yl)methyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 106005945 |
| Molecular Formula | C15H13N3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-[(5-ethylthiophen-2-yl)methyl]-2-sulfanylidene-1H-benzimidazole-5-carbonitrile |
| SMILES | CCc1ccc(Cn2c(=S)[nH]c3ccc(C#N)cc32)s1 |
| InChI | InChI=1S/C15H13N3S2/c1-2-11-4-5-12(20-11)9-18-14-7-10(8-16)3-6-13(14)17-15(18)19/h3-7H,2,9H2,1H3,(H,17,19) |
| InChIKey | LIPQSSFOYKIEQK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|