C13H14N2S2 — CID 106431411
5-methyl-3-(2-prop-2-ynylsulfanylethyl)-1H-benzimidazole-2-thione (PubChem CID 106431411) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 5-methyl-3-(2-prop-2-ynylsulfanylethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-methyl-3-(2-prop-2-ynylsulfanylethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106431411 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 5-methyl-3-(2-prop-2-ynylsulfanylethyl)-1H-benzimidazole-2-thione |
| SMILES | C#CCSCCn1c(=S)[nH]c2ccc(C)cc21 |
| InChI | InChI=1S/C13H14N2S2/c1-3-7-17-8-6-15-12-9-10(2)4-5-11(12)14-13(15)16/h1,4-5,9H,6-8H2,2H3,(H,14,16) |
| InChIKey | WAZZDBWCKKKVMZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|