C12H11N3OS — CID 114186474
5-methyl-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 114186474) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 5-methyl-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-methyl-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114186474 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 5-methyl-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2[nH]c(=S)n(Cc3ccno3)c2c1 |
| InChI | InChI=1S/C12H11N3OS/c1-8-2-3-10-11(6-8)15(12(17)14-10)7-9-4-5-13-16-9/h2-6H,7H2,1H3,(H,14,17) |
| InChIKey | DROGQOUAHHSNNR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|