C13H12FN3OS — CID 79241740
3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 79241740) has the molecular formula C13H12FN3OS and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 79241740 |
| Molecular Formula | C13H12FN3OS |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | Cc1noc(C)c1Cn1c(=S)[nH]c2ccc(F)cc21 |
| InChI | InChI=1S/C13H12FN3OS/c1-7-10(8(2)18-16-7)6-17-12-5-9(14)3-4-11(12)15-13(17)19/h3-5H,6H2,1-2H3,(H,15,19) |
| InChIKey | IJEOXJSVGKGYMU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|