C15H13FN2OS — CID 62378537
5-fluoro-3-[(2-methoxyphenyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 62378537) has the molecular formula C15H13FN2OS and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-fluoro-3-[(2-methoxyphenyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-fluoro-3-[(2-methoxyphenyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 62378537 |
| Molecular Formula | C15H13FN2OS |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 5-fluoro-3-[(2-methoxyphenyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | COc1ccccc1Cn1c(=S)[nH]c2ccc(F)cc21 |
| InChI | InChI=1S/C15H13FN2OS/c1-19-14-5-3-2-4-10(14)9-18-13-8-11(16)6-7-12(13)17-15(18)20/h2-8H,9H2,1H3,(H,17,20) |
| InChIKey | QJAYAJJQQBRSMV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|