C14H12FN3OS — CID 62991053
5-fluoro-3-[(2-methoxy-4-pyridinyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 62991053) has the molecular formula C14H12FN3OS and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-fluoro-3-[(2-methoxy-4-pyridinyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-fluoro-3-[(2-methoxy-4-pyridinyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 62991053 |
| Molecular Formula | C14H12FN3OS |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 5-fluoro-3-[(2-methoxy-4-pyridinyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | COc1cc(Cn2c(=S)[nH]c3ccc(F)cc32)ccn1 |
| InChI | InChI=1S/C14H12FN3OS/c1-19-13-6-9(4-5-16-13)8-18-12-7-10(15)2-3-11(12)17-14(18)20/h2-7H,8H2,1H3,(H,17,20) |
| InChIKey | RHDZIXMFCQOYEI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|