C15H12BrFN2OS — CID 63597685
3-[(2-bromophenyl)methyl]-6-fluoro-5-methoxy-1H-benzimidazole-2-thione (PubChem CID 63597685) has the molecular formula C15H12BrFN2OS and a molecular weight of 367.24 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methyl]-6-fluoro-5-methoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-[(2-bromophenyl)methyl]-6-fluoro-5-methoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 63597685 |
| Molecular Formula | C15H12BrFN2OS |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 3-[(2-bromophenyl)methyl]-6-fluoro-5-methoxy-1H-benzimidazole-2-thione |
| SMILES | COc1cc2c(cc1F)[nH]c(=S)n2Cc1ccccc1Br |
| InChI | InChI=1S/C15H12BrFN2OS/c1-20-14-7-13-12(6-11(14)17)18-15(21)19(13)8-9-4-2-3-5-10(9)16/h2-7H,8H2,1H3,(H,18,21) |
| InChIKey | ZZGOZDQSIGNSGY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|