C14H9Br2FN2OS — CID 107601269
3-(2,6-dibromophenyl)-6-fluoro-5-methoxy-1H-benzimidazole-2-thione (PubChem CID 107601269) has the molecular formula C14H9Br2FN2OS and a molecular weight of 432.11 g/mol. Its IUPAC name is 3-(2,6-dibromophenyl)-6-fluoro-5-methoxy-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,6-dibromophenyl)-6-fluoro-5-methoxy-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107601269 |
| Molecular Formula | C14H9Br2FN2OS |
| Molecular Weight | 432.11 g/mol |
| Exact Mass | 429.88 |
| IUPAC Name | 3-(2,6-dibromophenyl)-6-fluoro-5-methoxy-1H-benzimidazole-2-thione |
| SMILES | COc1cc2c(cc1F)[nH]c(=S)n2-c1c(Br)cccc1Br |
| InChI | InChI=1S/C14H9Br2FN2OS/c1-20-12-6-11-10(5-9(12)17)18-14(21)19(11)13-7(15)3-2-4-8(13)16/h2-6H,1H3,(H,18,21) |
| InChIKey | XHHARRCUDXEHGI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.11 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|