C13H14F4N2OS — CID 115520845
6-fluoro-5-methoxy-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione (PubChem CID 115520845) has the molecular formula C13H14F4N2OS and a molecular weight of 322.33 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-5-methoxy-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115520845 |
| Molecular Formula | C13H14F4N2OS |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 6-fluoro-5-methoxy-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione |
| SMILES | COc1cc2c(cc1F)[nH]c(=S)n2CCCCC(F)(F)F |
| InChI | InChI=1S/C13H14F4N2OS/c1-20-11-7-10-9(6-8(11)14)18-12(21)19(10)5-3-2-4-13(15,16)17/h6-7H,2-5H2,1H3,(H,18,21) |
| InChIKey | PQAGFUWXYWATON-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|