C12H15FN2O3S2 — CID 63598040
6-fluoro-5-methoxy-3-(3-methylsulfonylpropyl)-1H-benzimidazole-2-thione (PubChem CID 63598040) has the molecular formula C12H15FN2O3S2 and a molecular weight of 318.40 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-3-(3-methylsulfonylpropyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-5-methoxy-3-(3-methylsulfonylpropyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 63598040 |
| Molecular Formula | C12H15FN2O3S2 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 6-fluoro-5-methoxy-3-(3-methylsulfonylpropyl)-1H-benzimidazole-2-thione |
| SMILES | COc1cc2c(cc1F)[nH]c(=S)n2CCCS(C)(=O)=O |
| InChI | InChI=1S/C12H15FN2O3S2/c1-18-11-7-10-9(6-8(11)13)14-12(19)15(10)4-3-5-20(2,16)17/h6-7H,3-5H2,1-2H3,(H,14,19) |
| InChIKey | YACLMOTYWYGNRM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|