C14H18FN3O2S — CID 106276676
3-(5-fluoro-6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide (PubChem CID 106276676) has the molecular formula C14H18FN3O2S and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-(5-fluoro-6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(5-fluoro-6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106276676 |
| Molecular Formula | C14H18FN3O2S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-(5-fluoro-6-methoxy-2-sulfanylidene-3H-benzimidazol-1-yl)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(=S)[nH]c2cc(F)c(OC)cc21 |
| InChI | InChI=1S/C14H18FN3O2S/c1-14(2,12(19)16-3)7-18-10-6-11(20-4)8(15)5-9(10)17-13(18)21/h5-6H,7H2,1-4H3,(H,16,19)(H,17,21) |
| InChIKey | HRXNJQKWCLZOQP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|