C12H12ClF3N2S — CID 115520840
6-chloro-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione (PubChem CID 115520840) has the molecular formula C12H12ClF3N2S and a molecular weight of 308.76 g/mol. Its IUPAC name is 6-chloro-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115520840 |
| Molecular Formula | C12H12ClF3N2S |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 6-chloro-3-(5,5,5-trifluoropentyl)-1H-benzimidazole-2-thione |
| SMILES | FC(F)(F)CCCCn1c(=S)[nH]c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H12ClF3N2S/c13-8-3-4-10-9(7-8)17-11(19)18(10)6-2-1-5-12(14,15)16/h3-4,7H,1-2,5-6H2,(H,17,19) |
| InChIKey | UPCRGSWXGSSPFO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|