C10H8ClF3N2S — CID 115470095
5-chloro-3-(3,3,3-trifluoropropyl)-1H-benzimidazole-2-thione (PubChem CID 115470095) has the molecular formula C10H8ClF3N2S and a molecular weight of 280.70 g/mol. Its IUPAC name is 5-chloro-3-(3,3,3-trifluoropropyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-(3,3,3-trifluoropropyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115470095 |
| Molecular Formula | C10H8ClF3N2S |
| Molecular Weight | 280.70 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 5-chloro-3-(3,3,3-trifluoropropyl)-1H-benzimidazole-2-thione |
| SMILES | FC(F)(F)CCn1c(=S)[nH]c2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H8ClF3N2S/c11-6-1-2-7-8(5-6)16(9(17)15-7)4-3-10(12,13)14/h1-2,5H,3-4H2,(H,15,17) |
| InChIKey | ZNJIDLONBUAZSH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|