C11H11ClF2N2OS — CID 114126804
5-chloro-3-[2-(2,2-difluoroethoxy)ethyl]-1H-benzimidazole-2-thione (PubChem CID 114126804) has the molecular formula C11H11ClF2N2OS and a molecular weight of 292.74 g/mol. Its IUPAC name is 5-chloro-3-[2-(2,2-difluoroethoxy)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-[2-(2,2-difluoroethoxy)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114126804 |
| Molecular Formula | C11H11ClF2N2OS |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 5-chloro-3-[2-(2,2-difluoroethoxy)ethyl]-1H-benzimidazole-2-thione |
| SMILES | FC(F)COCCn1c(=S)[nH]c2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H11ClF2N2OS/c12-7-1-2-8-9(5-7)16(11(18)15-8)3-4-17-6-10(13)14/h1-2,5,10H,3-4,6H2,(H,15,18) |
| InChIKey | GSFCLKWCYSDJBC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|