C13H14ClFN2OS — CID 106405773
3-(2-but-3-enoxyethyl)-6-chloro-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 106405773) has the molecular formula C13H14ClFN2OS and a molecular weight of 300.79 g/mol. Its IUPAC name is 3-(2-but-3-enoxyethyl)-6-chloro-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-(2-but-3-enoxyethyl)-6-chloro-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106405773 |
| Molecular Formula | C13H14ClFN2OS |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-(2-but-3-enoxyethyl)-6-chloro-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | C=CCCOCCn1c(=S)[nH]c2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C13H14ClFN2OS/c1-2-3-5-18-6-4-17-12-8-10(15)9(14)7-11(12)16-13(17)19/h2,7-8H,1,3-6H2,(H,16,19) |
| InChIKey | WALRXBLXSSNGPG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|