C12H12ClFN2S — CID 66077899
6-chloro-3-(2-cyclopropylethyl)-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 66077899) has the molecular formula C12H12ClFN2S and a molecular weight of 270.76 g/mol. Its IUPAC name is 6-chloro-3-(2-cyclopropylethyl)-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 6-chloro-3-(2-cyclopropylethyl)-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66077899 |
| Molecular Formula | C12H12ClFN2S |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 6-chloro-3-(2-cyclopropylethyl)-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2c(cc1Cl)[nH]c(=S)n2CCC1CC1 |
| InChI | InChI=1S/C12H12ClFN2S/c13-8-5-10-11(6-9(8)14)16(12(17)15-10)4-3-7-1-2-7/h5-7H,1-4H2,(H,15,17) |
| InChIKey | KOBSWYYEACBBRV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|