C11H13ClFN3S — CID 114089291
5-chloro-3-[2-(dimethylamino)ethyl]-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 114089291) has the molecular formula C11H13ClFN3S and a molecular weight of 273.76 g/mol. Its IUPAC name is 5-chloro-3-[2-(dimethylamino)ethyl]-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-3-[2-(dimethylamino)ethyl]-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114089291 |
| Molecular Formula | C11H13ClFN3S |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 5-chloro-3-[2-(dimethylamino)ethyl]-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | CN(C)CCn1c(=S)[nH]c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C11H13ClFN3S/c1-15(2)3-4-16-10-5-7(12)8(13)6-9(10)14-11(16)17/h5-6H,3-4H2,1-2H3,(H,14,17) |
| InChIKey | UGFBXARJVWZSAJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|