C12H12ClFN2S2 — CID 106431360
5-chloro-6-fluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione (PubChem CID 106431360) has the molecular formula C12H12ClFN2S2 and a molecular weight of 302.83 g/mol. Its IUPAC name is 5-chloro-6-fluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-chloro-6-fluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106431360 |
| Molecular Formula | C12H12ClFN2S2 |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5-chloro-6-fluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione |
| SMILES | C=CCSCCn1c(=S)[nH]c2cc(F)c(Cl)cc21 |
| InChI | InChI=1S/C12H12ClFN2S2/c1-2-4-18-5-3-16-11-6-8(13)9(14)7-10(11)15-12(16)17/h2,6-7H,1,3-5H2,(H,15,17) |
| InChIKey | BKNBQGBZGDDVSO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|