C12H12F2N2S2 — CID 106431371
5,7-difluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione (PubChem CID 106431371) has the molecular formula C12H12F2N2S2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 5,7-difluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5,7-difluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106431371 |
| Molecular Formula | C12H12F2N2S2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 5,7-difluoro-3-(2-prop-2-enylsulfanylethyl)-1H-benzimidazole-2-thione |
| SMILES | C=CCSCCn1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H12F2N2S2/c1-2-4-18-5-3-16-10-7-8(13)6-9(14)11(10)15-12(16)17/h2,6-7H,1,3-5H2,(H,15,17) |
| InChIKey | SGGBTNFANKEWNK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|