C11H7F2N3OS — CID 106419518
5,7-difluoro-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione (PubChem CID 106419518) has the molecular formula C11H7F2N3OS and a molecular weight of 267.26 g/mol. Its IUPAC name is 5,7-difluoro-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione.
| Compound Name | 5,7-difluoro-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106419518 |
| Molecular Formula | C11H7F2N3OS |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 5,7-difluoro-3-(1,2-oxazol-5-ylmethyl)-1H-benzimidazole-2-thione |
| SMILES | Fc1cc(F)c2[nH]c(=S)n(Cc3ccno3)c2c1 |
| InChI | InChI=1S/C11H7F2N3OS/c12-6-3-8(13)10-9(4-6)16(11(18)15-10)5-7-1-2-14-17-7/h1-4H,5H2,(H,15,18) |
| InChIKey | OHFGFBGUADZQCA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|