C14H12F2N2S2 — CID 115508474
3-[(3-ethylthiophen-2-yl)methyl]-5,7-difluoro-1H-benzimidazole-2-thione (PubChem CID 115508474) has the molecular formula C14H12F2N2S2 and a molecular weight of 310.39 g/mol. Its IUPAC name is 3-[(3-ethylthiophen-2-yl)methyl]-5,7-difluoro-1H-benzimidazole-2-thione.
| Compound Name | 3-[(3-ethylthiophen-2-yl)methyl]-5,7-difluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115508474 |
| Molecular Formula | C14H12F2N2S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 3-[(3-ethylthiophen-2-yl)methyl]-5,7-difluoro-1H-benzimidazole-2-thione |
| SMILES | CCc1ccsc1Cn1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H12F2N2S2/c1-2-8-3-4-20-12(8)7-18-11-6-9(15)5-10(16)13(11)17-14(18)19/h3-6H,2,7H2,1H3,(H,17,19) |
| InChIKey | GLOICSBWWJFKCJ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|