C12H9F2N3S2 — CID 115508421
5,7-difluoro-3-[1-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 115508421) has the molecular formula C12H9F2N3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 5,7-difluoro-3-[1-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5,7-difluoro-3-[1-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115508421 |
| Molecular Formula | C12H9F2N3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 5,7-difluoro-3-[1-(1,3-thiazol-2-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | CC(c1nccs1)n1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H9F2N3S2/c1-6(11-15-2-3-19-11)17-9-5-7(13)4-8(14)10(9)16-12(17)18/h2-6H,1H3,(H,16,18) |
| InChIKey | IYCYRTKXBGMSQD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|