C14H12F2N2OS — CID 115508228
5,7-difluoro-3-[1-(furan-2-yl)propan-2-yl]-1H-benzimidazole-2-thione (PubChem CID 115508228) has the molecular formula C14H12F2N2OS and a molecular weight of 294.33 g/mol. Its IUPAC name is 5,7-difluoro-3-[1-(furan-2-yl)propan-2-yl]-1H-benzimidazole-2-thione.
| Compound Name | 5,7-difluoro-3-[1-(furan-2-yl)propan-2-yl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115508228 |
| Molecular Formula | C14H12F2N2OS |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5,7-difluoro-3-[1-(furan-2-yl)propan-2-yl]-1H-benzimidazole-2-thione |
| SMILES | CC(Cc1ccco1)n1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C14H12F2N2OS/c1-8(5-10-3-2-4-19-10)18-12-7-9(15)6-11(16)13(12)17-14(18)20/h2-4,6-8H,5H2,1H3,(H,17,20) |
| InChIKey | LRKCCNHBGWQLFY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|