C15H16N2OS — CID 115551754
3-[1-(furan-2-yl)propan-2-yl]-4-methyl-1H-benzimidazole-2-thione (PubChem CID 115551754) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[1-(furan-2-yl)propan-2-yl]-4-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-[1-(furan-2-yl)propan-2-yl]-4-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 115551754 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[1-(furan-2-yl)propan-2-yl]-4-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cccc2[nH]c(=S)n(C(C)Cc3ccco3)c12 |
| InChI | InChI=1S/C15H16N2OS/c1-10-5-3-7-13-14(10)17(15(19)16-13)11(2)9-12-6-4-8-18-12/h3-8,11H,9H2,1-2H3,(H,16,19) |
| InChIKey | YSSOEOMIMWQKTC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|