C9H11N3OS — CID 61472377
4-[1-(furan-2-yl)propan-2-yl]-1H-1,2,4-triazole-5-thione (PubChem CID 61472377) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 4-[1-(furan-2-yl)propan-2-yl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[1-(furan-2-yl)propan-2-yl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 61472377 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-[1-(furan-2-yl)propan-2-yl]-1H-1,2,4-triazole-5-thione |
| SMILES | CC(Cc1ccco1)n1cn[nH]c1=S |
| InChI | InChI=1S/C9H11N3OS/c1-7(5-8-3-2-4-13-8)12-6-10-11-9(12)14/h2-4,6-7H,5H2,1H3,(H,11,14) |
| InChIKey | KERDLOVZUSBKDM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|