C16H15ClN2S — CID 63546403
4-chloro-3-(1-phenylpropan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 63546403) has the molecular formula C16H15ClN2S and a molecular weight of 302.83 g/mol. Its IUPAC name is 4-chloro-3-(1-phenylpropan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 4-chloro-3-(1-phenylpropan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 63546403 |
| Molecular Formula | C16H15ClN2S |
| Molecular Weight | 302.83 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-chloro-3-(1-phenylpropan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CC(Cc1ccccc1)n1c(=S)[nH]c2cccc(Cl)c21 |
| InChI | InChI=1S/C16H15ClN2S/c1-11(10-12-6-3-2-4-7-12)19-15-13(17)8-5-9-14(15)18-16(19)20/h2-9,11H,10H2,1H3,(H,18,20) |
| InChIKey | OMHNSPIEECGEGV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.83 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|