C15H13ClF2N2O — CID 115509302
2-(chloromethyl)-4,6-difluoro-1-[1-(furan-2-yl)propan-2-yl]benzimidazole (PubChem CID 115509302) has the molecular formula C15H13ClF2N2O and a molecular weight of 310.73 g/mol. Its IUPAC name is 2-(chloromethyl)-4,6-difluoro-1-[1-(furan-2-yl)propan-2-yl]benzimidazole.
| Compound Name | 2-(chloromethyl)-4,6-difluoro-1-[1-(furan-2-yl)propan-2-yl]benzimidazole |
|---|---|
| PubChem CID | 115509302 |
| Molecular Formula | C15H13ClF2N2O |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-(chloromethyl)-4,6-difluoro-1-[1-(furan-2-yl)propan-2-yl]benzimidazole |
| SMILES | CC(Cc1ccco1)n1c(CCl)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C15H13ClF2N2O/c1-9(5-11-3-2-4-21-11)20-13-7-10(17)6-12(18)15(13)19-14(20)8-16/h2-4,6-7,9H,5,8H2,1H3 |
| InChIKey | TYPGSFKHRSLWDF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|