C15H14Cl2N2O — CID 61472347
5-chloro-2-(chloromethyl)-1-[1-(furan-2-yl)propan-2-yl]benzimidazole (PubChem CID 61472347) has the molecular formula C15H14Cl2N2O and a molecular weight of 309.20 g/mol. Its IUPAC name is 5-chloro-2-(chloromethyl)-1-[1-(furan-2-yl)propan-2-yl]benzimidazole.
| Compound Name | 5-chloro-2-(chloromethyl)-1-[1-(furan-2-yl)propan-2-yl]benzimidazole |
|---|---|
| PubChem CID | 61472347 |
| Molecular Formula | C15H14Cl2N2O |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 5-chloro-2-(chloromethyl)-1-[1-(furan-2-yl)propan-2-yl]benzimidazole |
| SMILES | CC(Cc1ccco1)n1c(CCl)nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H14Cl2N2O/c1-10(7-12-3-2-6-20-12)19-14-5-4-11(17)8-13(14)18-15(19)9-16/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | RECCDGHQOAJDQW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|