About 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide
2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide (PubChem CID 115508222) has the molecular formula C12H13F2N3OS
and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide |
| PubChem CID | 115508222 |
| Molecular Formula | C12H13F2N3OS |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)n1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H13F2N3OS/c1-6(11(18)16(2)3)17-9-5-7(13)4-8(14)10(9)15-12(17)19/h4-6H,1-3H3,(H,15,19) |
| InChIKey | BQPRIHASKSQYLQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide?
The IUPAC name of 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide (CID 115508222) is 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide.
What is the SMILES notation for 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide?
The canonical SMILES for 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide is CC(C(=O)N(C)C)n1c(=S)[nH]c2c(F)cc(F)cc21.
What is the InChIKey of 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide?
The InChIKey is BQPRIHASKSQYLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3OS/c1-6(11(18)16(2)3)17-9-5-7(13)4-8(14)10(9)15-12(17)19/h4-6H,1-3H3,(H,15,19).
What are the key properties of 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide?
2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide has a molecular weight of 285.32 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide is sourced from PubChem (CID 115508222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).