C12H13F2N3OS — CID 115508222
2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide (PubChem CID 115508222) has the molecular formula C12H13F2N3OS and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide.
| Compound Name | 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 115508222 |
| Molecular Formula | C12H13F2N3OS |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-(4,6-difluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)n1c(=S)[nH]c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H13F2N3OS/c1-6(11(18)16(2)3)17-9-5-7(13)4-8(14)10(9)15-12(17)19/h4-6H,1-3H3,(H,15,19) |
| InChIKey | BQPRIHASKSQYLQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|