C13H15BrFN3OS — CID 103112126
2-(5-bromo-6-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-ethyl-N-methylpropanamide (PubChem CID 103112126) has the molecular formula C13H15BrFN3OS and a molecular weight of 360.25 g/mol. Its IUPAC name is 2-(5-bromo-6-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-ethyl-N-methylpropanamide.
| Compound Name | 2-(5-bromo-6-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103112126 |
| Molecular Formula | C13H15BrFN3OS |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 2-(5-bromo-6-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)n1c(=S)[nH]c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C13H15BrFN3OS/c1-4-17(3)12(19)7(2)18-11-6-9(15)8(14)5-10(11)16-13(18)20/h5-7H,4H2,1-3H3,(H,16,20) |
| InChIKey | BTHUHXQIDWHGAP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|