C12H15BrFN3S — CID 66088990
6-bromo-3-[2-(dimethylamino)propyl]-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 66088990) has the molecular formula C12H15BrFN3S and a molecular weight of 332.24 g/mol. Its IUPAC name is 6-bromo-3-[2-(dimethylamino)propyl]-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-3-[2-(dimethylamino)propyl]-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66088990 |
| Molecular Formula | C12H15BrFN3S |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 6-bromo-3-[2-(dimethylamino)propyl]-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | CC(Cn1c(=S)[nH]c2cc(Br)c(F)cc21)N(C)C |
| InChI | InChI=1S/C12H15BrFN3S/c1-7(16(2)3)6-17-11-5-9(14)8(13)4-10(11)15-12(17)18/h4-5,7H,6H2,1-3H3,(H,15,18) |
| InChIKey | XRMDKVIJJWQMMS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 23.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|