C11H16N4S — CID 79295922
1-[2-(dimethylamino)propyl]-3H-imidazo[4,5-c]pyridine-2-thione (PubChem CID 79295922) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is 1-[2-(dimethylamino)propyl]-3H-imidazo[4,5-c]pyridine-2-thione.
| Compound Name | 1-[2-(dimethylamino)propyl]-3H-imidazo[4,5-c]pyridine-2-thione |
|---|---|
| PubChem CID | 79295922 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-[2-(dimethylamino)propyl]-3H-imidazo[4,5-c]pyridine-2-thione |
| SMILES | CC(Cn1c(=S)[nH]c2cnccc21)N(C)C |
| InChI | InChI=1S/C11H16N4S/c1-8(14(2)3)7-15-10-4-5-12-6-9(10)13-11(15)16/h4-6,8H,7H2,1-3H3,(H,13,16) |
| InChIKey | PWJIFWOIVYSTFY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|