C11H17N5 — CID 79296345
1-[2-(dimethylamino)propyl]imidazo[4,5-c]pyridin-2-amine (PubChem CID 79296345) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-[2-(dimethylamino)propyl]imidazo[4,5-c]pyridin-2-amine.
| Compound Name | 1-[2-(dimethylamino)propyl]imidazo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 79296345 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 1-[2-(dimethylamino)propyl]imidazo[4,5-c]pyridin-2-amine |
| SMILES | CC(Cn1c(N)nc2cnccc21)N(C)C |
| InChI | InChI=1S/C11H17N5/c1-8(15(2)3)7-16-10-4-5-13-6-9(10)14-11(16)12/h4-6,8H,7H2,1-3H3,(H2,12,14) |
| InChIKey | IKRCVJFBRMRYTK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |