C14H18BrFN2S — CID 66088418
6-bromo-5-fluoro-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 66088418) has the molecular formula C14H18BrFN2S and a molecular weight of 345.28 g/mol. Its IUPAC name is 6-bromo-5-fluoro-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-5-fluoro-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66088418 |
| Molecular Formula | C14H18BrFN2S |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 6-bromo-5-fluoro-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CC(C)CCC(C)n1c(=S)[nH]c2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C14H18BrFN2S/c1-8(2)4-5-9(3)18-13-7-11(16)10(15)6-12(13)17-14(18)19/h6-9H,4-5H2,1-3H3,(H,17,19) |
| InChIKey | STYQXVGGDGQRLL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|