C15H21FN2OS — CID 63925915
6-fluoro-5-methoxy-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 63925915) has the molecular formula C15H21FN2OS and a molecular weight of 296.41 g/mol. Its IUPAC name is 6-fluoro-5-methoxy-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-5-methoxy-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 63925915 |
| Molecular Formula | C15H21FN2OS |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 6-fluoro-5-methoxy-3-(5-methylhexan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | COc1cc2c(cc1F)[nH]c(=S)n2C(C)CCC(C)C |
| InChI | InChI=1S/C15H21FN2OS/c1-9(2)5-6-10(3)18-13-8-14(19-4)11(16)7-12(13)17-15(18)20/h7-10H,5-6H2,1-4H3,(H,17,20) |
| InChIKey | KEQJXDPURKILFA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|