C12H14FIN2S — CID 66100129
5-fluoro-6-iodo-3-pentan-2-yl-1H-benzimidazole-2-thione (PubChem CID 66100129) has the molecular formula C12H14FIN2S and a molecular weight of 364.23 g/mol. Its IUPAC name is 5-fluoro-6-iodo-3-pentan-2-yl-1H-benzimidazole-2-thione.
| Compound Name | 5-fluoro-6-iodo-3-pentan-2-yl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66100129 |
| Molecular Formula | C12H14FIN2S |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 5-fluoro-6-iodo-3-pentan-2-yl-1H-benzimidazole-2-thione |
| SMILES | CCCC(C)n1c(=S)[nH]c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C12H14FIN2S/c1-3-4-7(2)16-11-5-8(13)9(14)6-10(11)15-12(16)17/h5-7H,3-4H2,1-2H3,(H,15,17) |
| InChIKey | OEFVRUICFSQLBP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|