C11H12BrFN2S2 — CID 116737904
5-bromo-6-fluoro-3-(1-methylsulfanylpropan-2-yl)-1H-benzimidazole-2-thione (PubChem CID 116737904) has the molecular formula C11H12BrFN2S2 and a molecular weight of 335.27 g/mol. Its IUPAC name is 5-bromo-6-fluoro-3-(1-methylsulfanylpropan-2-yl)-1H-benzimidazole-2-thione.
| Compound Name | 5-bromo-6-fluoro-3-(1-methylsulfanylpropan-2-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 116737904 |
| Molecular Formula | C11H12BrFN2S2 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 5-bromo-6-fluoro-3-(1-methylsulfanylpropan-2-yl)-1H-benzimidazole-2-thione |
| SMILES | CSCC(C)n1c(=S)[nH]c2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C11H12BrFN2S2/c1-6(5-17-2)15-10-3-7(12)8(13)4-9(10)14-11(15)16/h3-4,6H,5H2,1-2H3,(H,14,16) |
| InChIKey | PEXMPPIDTZKSFV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|