C15H22FN3O — CID 63924917
5-fluoro-6-methoxy-1-(5-methylhexan-2-yl)benzimidazol-2-amine (PubChem CID 63924917) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is 5-fluoro-6-methoxy-1-(5-methylhexan-2-yl)benzimidazol-2-amine.
| Compound Name | 5-fluoro-6-methoxy-1-(5-methylhexan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 63924917 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 5-fluoro-6-methoxy-1-(5-methylhexan-2-yl)benzimidazol-2-amine |
| SMILES | COc1cc2c(cc1F)nc(N)n2C(C)CCC(C)C |
| InChI | InChI=1S/C15H22FN3O/c1-9(2)5-6-10(3)19-13-8-14(20-4)11(16)7-12(13)18-15(19)17/h7-10H,5-6H2,1-4H3,(H2,17,18) |
| InChIKey | DVIQMCLPQAFUFU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |