C14H20ClN3 — CID 113316215
6-chloro-1-(5-methylhexan-2-yl)benzimidazol-2-amine (PubChem CID 113316215) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 6-chloro-1-(5-methylhexan-2-yl)benzimidazol-2-amine.
| Compound Name | 6-chloro-1-(5-methylhexan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 113316215 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-chloro-1-(5-methylhexan-2-yl)benzimidazol-2-amine |
| SMILES | CC(C)CCC(C)n1c(N)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H20ClN3/c1-9(2)4-5-10(3)18-13-8-11(15)6-7-12(13)17-14(18)16/h6-10H,4-5H2,1-3H3,(H2,16,17) |
| InChIKey | VLHVNWQDYNKIIR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |