C14H19BrFN3 — CID 66086898
5-bromo-6-fluoro-1-(5-methylhexan-2-yl)benzimidazol-2-amine (PubChem CID 66086898) has the molecular formula C14H19BrFN3 and a molecular weight of 328.23 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1-(5-methylhexan-2-yl)benzimidazol-2-amine.
| Compound Name | 5-bromo-6-fluoro-1-(5-methylhexan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66086898 |
| Molecular Formula | C14H19BrFN3 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 5-bromo-6-fluoro-1-(5-methylhexan-2-yl)benzimidazol-2-amine |
| SMILES | CC(C)CCC(C)n1c(N)nc2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C14H19BrFN3/c1-8(2)4-5-9(3)19-13-7-11(16)10(15)6-12(13)18-14(19)17/h6-9H,4-5H2,1-3H3,(H2,17,18) |
| InChIKey | WKNQBZBEIWYECK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |