C13H17BrFN3 — CID 116738290
6-bromo-5-fluoro-1-hexan-2-ylbenzimidazol-2-amine (PubChem CID 116738290) has the molecular formula C13H17BrFN3 and a molecular weight of 314.20 g/mol. Its IUPAC name is 6-bromo-5-fluoro-1-hexan-2-ylbenzimidazol-2-amine.
| Compound Name | 6-bromo-5-fluoro-1-hexan-2-ylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 116738290 |
| Molecular Formula | C13H17BrFN3 |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 6-bromo-5-fluoro-1-hexan-2-ylbenzimidazol-2-amine |
| SMILES | CCCCC(C)n1c(N)nc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C13H17BrFN3/c1-3-4-5-8(2)18-12-6-9(14)10(15)7-11(12)17-13(18)16/h6-8H,3-5H2,1-2H3,(H2,16,17) |
| InChIKey | GNESMNDZKNMMGM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |