C13H17ClFN3 — CID 66076948
5-chloro-6-fluoro-1-(4-methylpentan-2-yl)benzimidazol-2-amine (PubChem CID 66076948) has the molecular formula C13H17ClFN3 and a molecular weight of 269.75 g/mol. Its IUPAC name is 5-chloro-6-fluoro-1-(4-methylpentan-2-yl)benzimidazol-2-amine.
| Compound Name | 5-chloro-6-fluoro-1-(4-methylpentan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 66076948 |
| Molecular Formula | C13H17ClFN3 |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 5-chloro-6-fluoro-1-(4-methylpentan-2-yl)benzimidazol-2-amine |
| SMILES | CC(C)CC(C)n1c(N)nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C13H17ClFN3/c1-7(2)4-8(3)18-12-6-10(15)9(14)5-11(12)17-13(18)16/h5-8H,4H2,1-3H3,(H2,16,17) |
| InChIKey | DFYFRZJNCFEQRC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |